C32H34ClFN4O4S — CID 68874682
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-ethylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine (PubChem CID 68874682) has the molecular formula C32H34ClFN4O4S and a molecular weight of 625.17 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-ethylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-ethylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68874682 |
| Molecular Formula | C32H34ClFN4O4S |
| Molecular Weight | 625.17 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-ethylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine |
| SMILES | CCS(=O)(=O)CCNCCCC1(c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)CC=CO1 |
| InChI | InChI=1S/C32H34ClFN4O4S/c1-2-43(39,40)17-15-35-14-4-12-32(13-5-16-42-32)24-8-10-29-27(19-24)31(37-22-36-29)38-26-9-11-30(28(33)20-26)41-21-23-6-3-7-25(34)18-23/h3,5-11,16,18-20,22,35H,2,4,12-15,17,21H2,1H3,(H,36,37,38) |
| InChIKey | KWQHNCDRTGTBKR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.17 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|