C31H32BrFN4O4S — CID 68873287
N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-methylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine (PubChem CID 68873287) has the molecular formula C31H32BrFN4O4S and a molecular weight of 655.59 g/mol. Its IUPAC name is N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-methylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine.
| Compound Name | N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-methylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68873287 |
| Molecular Formula | C31H32BrFN4O4S |
| Molecular Weight | 655.59 g/mol |
| Exact Mass | 654.13 |
| IUPAC Name | N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[3-(2-methylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine |
| SMILES | CS(=O)(=O)CCNCCCC1(c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Br)c4)c3c2)CC=CO1 |
| InChI | InChI=1S/C31H32BrFN4O4S/c1-42(38,39)16-14-34-13-3-11-31(12-4-15-41-31)23-7-9-28-26(18-23)30(36-21-35-28)37-25-8-10-29(27(32)19-25)40-20-22-5-2-6-24(33)17-22/h2,4-10,15,17-19,21,34H,3,11-14,16,20H2,1H3,(H,35,36,37) |
| InChIKey | HLSGDMZRCPULFV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|