C32H30ClF2N3O5S — CID 87608611
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-fluoro-6-[2-[2-(3-methyl-2-sulfonylbutoxy)ethyl]-3H-furan-2-yl]quinazolin-4-amine (PubChem CID 87608611) has the molecular formula C32H30ClF2N3O5S and a molecular weight of 642.12 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-fluoro-6-[2-[2-(3-methyl-2-sulfonylbutoxy)ethyl]-3H-furan-2-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-fluoro-6-[2-[2-(3-methyl-2-sulfonylbutoxy)ethyl]-3H-furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 87608611 |
| Molecular Formula | C32H30ClF2N3O5S |
| Molecular Weight | 642.12 g/mol |
| Exact Mass | 641.16 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-fluoro-6-[2-[2-(3-methyl-2-sulfonylbutoxy)ethyl]-3H-furan-2-yl]quinazolin-4-amine |
| SMILES | CC(C)C(COCCC1(c2cc3c(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)ncnc3cc2F)CC=CO1)=S(=O)=O |
| InChI | InChI=1S/C32H30ClF2N3O5S/c1-20(2)30(44(39)40)18-41-12-10-32(9-4-11-43-32)25-15-24-28(16-27(25)35)36-19-37-31(24)38-23-7-8-29(26(33)14-23)42-17-21-5-3-6-22(34)13-21/h3-8,11,13-16,19-20H,9-10,12,17-18H2,1-2H3,(H,36,37,38) |
| InChIKey | KPMNYOGWDAFQDP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.12 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|