C33H28ClFN6O4S — CID 87609112
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[2-[(2-pyridin-2-yl-2-sulfonylethyl)amino]ethyl]-3H-furan-2-yl]pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 87609112) has the molecular formula C33H28ClFN6O4S and a molecular weight of 659.14 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[2-[(2-pyridin-2-yl-2-sulfonylethyl)amino]ethyl]-3H-furan-2-yl]pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[2-[(2-pyridin-2-yl-2-sulfonylethyl)amino]ethyl]-3H-furan-2-yl]pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 87609112 |
| Molecular Formula | C33H28ClFN6O4S |
| Molecular Weight | 659.14 g/mol |
| Exact Mass | 658.16 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[2-[(2-pyridin-2-yl-2-sulfonylethyl)amino]ethyl]-3H-furan-2-yl]pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | O=S(=O)=C(CNCCC1(c2cc3c(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)ncnc3cn2)CC=CO1)c1ccccn1 |
| InChI | InChI=1S/C33H28ClFN6O4S/c34-26-16-24(8-9-29(26)44-20-22-5-3-6-23(35)15-22)41-32-25-17-31(38-18-28(25)39-21-40-32)33(10-4-14-45-33)11-13-36-19-30(46(42)43)27-7-1-2-12-37-27/h1-9,12,14-18,21,36H,10-11,13,19-20H2,(H,39,40,41) |
| InChIKey | CYRHDGKGFJPRNS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.14 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|