C34H28ClFN4O5S — CID 69398621
2-[[2-(benzenesulfonyl)ethylamino]methyl]-2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-3-one (PubChem CID 69398621) has the molecular formula C34H28ClFN4O5S and a molecular weight of 659.14 g/mol. Its IUPAC name is 2-[[2-(benzenesulfonyl)ethylamino]methyl]-2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-3-one.
| Compound Name | 2-[[2-(benzenesulfonyl)ethylamino]methyl]-2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-3-one |
|---|---|
| PubChem CID | 69398621 |
| Molecular Formula | C34H28ClFN4O5S |
| Molecular Weight | 659.14 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | 2-[[2-(benzenesulfonyl)ethylamino]methyl]-2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-3-one |
| SMILES | O=C1C=COC1(CNCCS(=O)(=O)c1ccccc1)c1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C34H28ClFN4O5S/c35-29-19-26(10-12-31(29)44-20-23-5-4-6-25(36)17-23)40-33-28-18-24(9-11-30(28)38-22-39-33)34(32(41)13-15-45-34)21-37-14-16-46(42,43)27-7-2-1-3-8-27/h1-13,15,17-19,22,37H,14,16,20-21H2,(H,38,39,40) |
| InChIKey | WKIJDFLCJGUAOD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.14 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|