C24H23N5O4S — CID 134153313
N-[4-[4-(benzenesulfonamido)anilino]-7-methoxyquinazolin-6-yl]propanamide (PubChem CID 134153313) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[4-[4-(benzenesulfonamido)anilino]-7-methoxyquinazolin-6-yl]propanamide.
| Compound Name | N-[4-[4-(benzenesulfonamido)anilino]-7-methoxyquinazolin-6-yl]propanamide |
|---|---|
| PubChem CID | 134153313 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[4-[4-(benzenesulfonamido)anilino]-7-methoxyquinazolin-6-yl]propanamide |
| SMILES | CCC(=O)Nc1cc2c(Nc3ccc(NS(=O)(=O)c4ccccc4)cc3)ncnc2cc1OC |
| InChI | InChI=1S/C24H23N5O4S/c1-3-23(30)28-21-13-19-20(14-22(21)33-2)25-15-26-24(19)27-16-9-11-17(12-10-16)29-34(31,32)18-7-5-4-6-8-18/h4-15,29H,3H2,1-2H3,(H,28,30)(H,25,26,27) |
| InChIKey | XILHUDGNEDEXFJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |