C26H16ClN3O4 — CID 71556920
[2-chloro-4-[[6-(5-formylfuran-2-yl)quinazolin-4-yl]amino]phenyl] benzoate (PubChem CID 71556920) has the molecular formula C26H16ClN3O4 and a molecular weight of 469.88 g/mol. Its IUPAC name is [2-chloro-4-[[6-(5-formylfuran-2-yl)quinazolin-4-yl]amino]phenyl] benzoate.
| Compound Name | [2-chloro-4-[[6-(5-formylfuran-2-yl)quinazolin-4-yl]amino]phenyl] benzoate |
|---|---|
| PubChem CID | 71556920 |
| Molecular Formula | C26H16ClN3O4 |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | [2-chloro-4-[[6-(5-formylfuran-2-yl)quinazolin-4-yl]amino]phenyl] benzoate |
| SMILES | O=Cc1ccc(-c2ccc3ncnc(Nc4ccc(OC(=O)c5ccccc5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C26H16ClN3O4/c27-21-13-18(7-10-24(21)34-26(32)16-4-2-1-3-5-16)30-25-20-12-17(6-9-22(20)28-15-29-25)23-11-8-19(14-31)33-23/h1-15H,(H,28,29,30) |
| InChIKey | ALIQPZYPVNVJLL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|