C36H32ClFN4O2S — CID 142038796
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[3-(2-phenylsulfanylethylamino)propyl]furan-2-yl]quinazolin-4-amine (PubChem CID 142038796) has the molecular formula C36H32ClFN4O2S and a molecular weight of 639.20 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[3-(2-phenylsulfanylethylamino)propyl]furan-2-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[3-(2-phenylsulfanylethylamino)propyl]furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 142038796 |
| Molecular Formula | C36H32ClFN4O2S |
| Molecular Weight | 639.20 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[3-(2-phenylsulfanylethylamino)propyl]furan-2-yl]quinazolin-4-amine |
| SMILES | Fc1cccc(COc2ccc(Nc3ncnc4ccc(-c5ccc(CCCNCCSc6ccccc6)o5)cc34)cc2Cl)c1 |
| InChI | InChI=1S/C36H32ClFN4O2S/c37-32-22-28(12-15-35(32)43-23-25-6-4-7-27(38)20-25)42-36-31-21-26(11-14-33(31)40-24-41-36)34-16-13-29(44-34)8-5-17-39-18-19-45-30-9-2-1-3-10-30/h1-4,6-7,9-16,20-22,24,39H,5,8,17-19,23H2,(H,40,41,42) |
| InChIKey | KJUUWXWCJWLBCJ-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.20 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|