C34H34ClFN3O5P — CID 158650208
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[4-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)butyl]furan-2-yl]quinazolin-4-amine (PubChem CID 158650208) has the molecular formula C34H34ClFN3O5P and a molecular weight of 650.09 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[4-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)butyl]furan-2-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[4-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)butyl]furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 158650208 |
| Molecular Formula | C34H34ClFN3O5P |
| Molecular Weight | 650.09 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[4-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)butyl]furan-2-yl]quinazolin-4-amine |
| SMILES | CC1(C)COP(=O)(CCCCc2ccc(-c3ccc4ncnc(Nc5ccc(OCc6cccc(F)c6)c(Cl)c5)c4c3)o2)OC1 |
| InChI | InChI=1S/C34H34ClFN3O5P/c1-34(2)20-42-45(40,43-21-34)15-4-3-8-27-11-14-31(44-27)24-9-12-30-28(17-24)33(38-22-37-30)39-26-10-13-32(29(35)18-26)41-19-23-6-5-7-25(36)16-23/h5-7,9-14,16-18,22H,3-4,8,15,19-21H2,1-2H3,(H,37,38,39) |
| InChIKey | IBLNAQRMRPWEQU-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.09 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|