C21H13ClIN3O2 — CID 71556919
[2-chloro-4-[(6-iodoquinazolin-4-yl)amino]phenyl] benzoate (PubChem CID 71556919) has the molecular formula C21H13ClIN3O2 and a molecular weight of 501.71 g/mol. Its IUPAC name is [2-chloro-4-[(6-iodoquinazolin-4-yl)amino]phenyl] benzoate.
| Compound Name | [2-chloro-4-[(6-iodoquinazolin-4-yl)amino]phenyl] benzoate |
|---|---|
| PubChem CID | 71556919 |
| Molecular Formula | C21H13ClIN3O2 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 500.97 |
| IUPAC Name | [2-chloro-4-[(6-iodoquinazolin-4-yl)amino]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(Nc2ncnc3ccc(I)cc23)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H13ClIN3O2/c22-17-11-15(7-9-19(17)28-21(27)13-4-2-1-3-5-13)26-20-16-10-14(23)6-8-18(16)24-12-25-20/h1-12H,(H,24,25,26) |
| InChIKey | HPXMUGMCNQRBCL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|