C24H23Cl3N4O2 — CID 18967674
[2-chloro-4-[[6-[2-(methylamino)ethoxy]quinazolin-4-yl]amino]phenyl]-phenylmethanone;dihydrochloride (PubChem CID 18967674) has the molecular formula C24H23Cl3N4O2 and a molecular weight of 505.83 g/mol. Its IUPAC name is [2-chloro-4-[[6-[2-(methylamino)ethoxy]quinazolin-4-yl]amino]phenyl]-phenylmethanone;dihydrochloride.
| Compound Name | [2-chloro-4-[[6-[2-(methylamino)ethoxy]quinazolin-4-yl]amino]phenyl]-phenylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 18967674 |
| Molecular Formula | C24H23Cl3N4O2 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | [2-chloro-4-[[6-[2-(methylamino)ethoxy]quinazolin-4-yl]amino]phenyl]-phenylmethanone;dihydrochloride |
| SMILES | CNCCOc1ccc2ncnc(Nc3ccc(C(=O)c4ccccc4)c(Cl)c3)c2c1.Cl.Cl |
| InChI | InChI=1S/C24H21ClN4O2.2ClH/c1-26-11-12-31-18-8-10-22-20(14-18)24(28-15-27-22)29-17-7-9-19(21(25)13-17)23(30)16-5-3-2-4-6-16;;/h2-10,13-15,26H,11-12H2,1H3,(H,27,28,29);2*1H |
| InChIKey | WBYLMORIIISYSU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|