C22H23ClFN3O3 — CID 66755682
ethyl 6-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]oxyhexanoate (PubChem CID 66755682) has the molecular formula C22H23ClFN3O3 and a molecular weight of 431.90 g/mol. Its IUPAC name is ethyl 6-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]oxyhexanoate.
| Compound Name | ethyl 6-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]oxyhexanoate |
|---|---|
| PubChem CID | 66755682 |
| Molecular Formula | C22H23ClFN3O3 |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | ethyl 6-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]oxyhexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccc2ncnc(Nc3ccc(F)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C22H23ClFN3O3/c1-2-29-21(28)6-4-3-5-11-30-16-8-10-20-17(13-16)22(26-14-25-20)27-15-7-9-19(24)18(23)12-15/h7-10,12-14H,2-6,11H2,1H3,(H,25,26,27) |
| InChIKey | BTWHSSXNHXWOJK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|