C24H26ClFN4O3 — CID 67362826
N-[4-[[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]oxymethoxy]cyclohexyl]-N-methylacetamide (PubChem CID 67362826) has the molecular formula C24H26ClFN4O3 and a molecular weight of 472.95 g/mol. Its IUPAC name is N-[4-[[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]oxymethoxy]cyclohexyl]-N-methylacetamide.
| Compound Name | N-[4-[[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]oxymethoxy]cyclohexyl]-N-methylacetamide |
|---|---|
| PubChem CID | 67362826 |
| Molecular Formula | C24H26ClFN4O3 |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[4-[[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]oxymethoxy]cyclohexyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)C1CCC(OCOc2ccc3ncnc(Nc4ccc(F)c(Cl)c4)c3c2)CC1 |
| InChI | InChI=1S/C24H26ClFN4O3/c1-15(31)30(2)17-4-6-18(7-5-17)32-14-33-19-8-10-23-20(12-19)24(28-13-27-23)29-16-3-9-22(26)21(25)11-16/h3,8-13,17-18H,4-7,14H2,1-2H3,(H,27,28,29) |
| InChIKey | AZRYVRBITYXHSZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|