C24H16ClN5O3 — CID 87424841
5-[4-[3-chloro-4-(pyrazin-2-ylmethoxy)anilino]quinazolin-6-yl]furan-2-carbaldehyde (PubChem CID 87424841) has the molecular formula C24H16ClN5O3 and a molecular weight of 457.88 g/mol. Its IUPAC name is 5-[4-[3-chloro-4-(pyrazin-2-ylmethoxy)anilino]quinazolin-6-yl]furan-2-carbaldehyde.
| Compound Name | 5-[4-[3-chloro-4-(pyrazin-2-ylmethoxy)anilino]quinazolin-6-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 87424841 |
| Molecular Formula | C24H16ClN5O3 |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 5-[4-[3-chloro-4-(pyrazin-2-ylmethoxy)anilino]quinazolin-6-yl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cnccn5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C24H16ClN5O3/c25-20-10-16(2-5-23(20)32-13-17-11-26-7-8-27-17)30-24-19-9-15(1-4-21(19)28-14-29-24)22-6-3-18(12-31)33-22/h1-12,14H,13H2,(H,28,29,30) |
| InChIKey | HMYOMIPDISNIHK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|