C16H13N3O5S — CID 169336206
4-(5-formylfuran-2-yl)-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide (PubChem CID 169336206) has the molecular formula C16H13N3O5S and a molecular weight of 359.36 g/mol. Its IUPAC name is 4-(5-formylfuran-2-yl)-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-(5-formylfuran-2-yl)-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 169336206 |
| Molecular Formula | C16H13N3O5S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-(5-formylfuran-2-yl)-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide |
| SMILES | COc1cnc(NS(=O)(=O)c2ccc(-c3ccc(C=O)o3)cc2)nc1 |
| InChI | InChI=1S/C16H13N3O5S/c1-23-13-8-17-16(18-9-13)19-25(21,22)14-5-2-11(3-6-14)15-7-4-12(10-20)24-15/h2-10H,1H3,(H,17,18,19) |
| InChIKey | YFAWHIIQILOZLT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|