C22H18ClN5O6S2 — CID 135686847
4-chloro-3-[5-methyl-3-oxo-4-[[4-(phenylsulfamoyl)phenyl]diazenyl]-1H-pyrazol-2-yl]benzenesulfonic acid (PubChem CID 135686847) has the molecular formula C22H18ClN5O6S2 and a molecular weight of 548.00 g/mol. Its IUPAC name is 4-chloro-3-[5-methyl-3-oxo-4-[[4-(phenylsulfamoyl)phenyl]diazenyl]-1H-pyrazol-2-yl]benzenesulfonic acid.
| Compound Name | 4-chloro-3-[5-methyl-3-oxo-4-[[4-(phenylsulfamoyl)phenyl]diazenyl]-1H-pyrazol-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135686847 |
| Molecular Formula | C22H18ClN5O6S2 |
| Molecular Weight | 548.00 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | 4-chloro-3-[5-methyl-3-oxo-4-[[4-(phenylsulfamoyl)phenyl]diazenyl]-1H-pyrazol-2-yl]benzenesulfonic acid |
| SMILES | Cc1[nH]n(-c2cc(S(=O)(=O)O)ccc2Cl)c(=O)c1/N=N/c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18ClN5O6S2/c1-14-21(22(29)28(26-14)20-13-18(36(32,33)34)11-12-19(20)23)25-24-15-7-9-17(10-8-15)35(30,31)27-16-5-3-2-4-6-16/h2-13,26-27H,1H3,(H,32,33,34)/b25-24+ |
| InChIKey | IHVQOQKIRFOIOO-OCOZRVBESA-N |
| XLogP | 4.59 |
| TPSA | 163.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.00 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|