C16H12Cl2N4O — CID 135981142
2-(2-chlorophenyl)-4-[(3-chlorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 135981142) has the molecular formula C16H12Cl2N4O and a molecular weight of 347.21 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-[(3-chlorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(2-chlorophenyl)-4-[(3-chlorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135981142 |
| Molecular Formula | C16H12Cl2N4O |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-(2-chlorophenyl)-4-[(3-chlorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2Cl)c(=O)c1/N=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N4O/c1-10-15(20-19-12-6-4-5-11(17)9-12)16(23)22(21-10)14-8-3-2-7-13(14)18/h2-9,21H,1H3/b20-19+ |
| InChIKey | PZFVOVWRDGHZJJ-FMQUCBEESA-N |
| XLogP | 5.20 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|