C15H11ClN4O2 — CID 137184042
4-[(3-chlorophenyl)diazenyl]-3-hydroxy-2-phenyl-1H-pyrazol-5-one (PubChem CID 137184042) has the molecular formula C15H11ClN4O2 and a molecular weight of 314.73 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)diazenyl]-3-hydroxy-2-phenyl-1H-pyrazol-5-one.
| Compound Name | 4-[(3-chlorophenyl)diazenyl]-3-hydroxy-2-phenyl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 137184042 |
| Molecular Formula | C15H11ClN4O2 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 4-[(3-chlorophenyl)diazenyl]-3-hydroxy-2-phenyl-1H-pyrazol-5-one |
| SMILES | O=c1[nH]n(-c2ccccc2)c(O)c1/N=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11ClN4O2/c16-10-5-4-6-11(9-10)17-18-13-14(21)19-20(15(13)22)12-7-2-1-3-8-12/h1-9,22H,(H,19,21)/b18-17+ |
| InChIKey | PXMRXPIBIAOSRC-ISLYRVAYSA-N |
| XLogP | 3.94 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|