C27H17ClN4O2 — CID 139224431
[9-[(3-chlorophenyl)diazenyl]-10-hydroxy-7H-pyrrolo[1,2-a]perimidin-8-yl]-phenylmethanone (PubChem CID 139224431) has the molecular formula C27H17ClN4O2 and a molecular weight of 464.91 g/mol. Its IUPAC name is [9-[(3-chlorophenyl)diazenyl]-10-hydroxy-7H-pyrrolo[1,2-a]perimidin-8-yl]-phenylmethanone.
| Compound Name | [9-[(3-chlorophenyl)diazenyl]-10-hydroxy-7H-pyrrolo[1,2-a]perimidin-8-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139224431 |
| Molecular Formula | C27H17ClN4O2 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | [9-[(3-chlorophenyl)diazenyl]-10-hydroxy-7H-pyrrolo[1,2-a]perimidin-8-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(/N=N/c2cccc(Cl)c2)c(O)n2c1[nH]c1cccc3cccc2c31 |
| InChI | InChI=1S/C27H17ClN4O2/c28-18-11-6-12-19(15-18)30-31-24-23(25(33)17-7-2-1-3-8-17)26-29-20-13-4-9-16-10-5-14-21(22(16)20)32(26)27(24)34/h1-15,29,34H/b31-30+ |
| InChIKey | DLFMEWRDICLFFK-NVQSTNCTSA-N |
| XLogP | 7.58 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|