C21H15ClN2O2 — CID 12781436
2-[(3-chlorophenyl)diazenyl]-1,3-diphenylpropane-1,3-dione (PubChem CID 12781436) has the molecular formula C21H15ClN2O2 and a molecular weight of 362.82 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)diazenyl]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[(3-chlorophenyl)diazenyl]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 12781436 |
| Molecular Formula | C21H15ClN2O2 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-[(3-chlorophenyl)diazenyl]-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(/N=N/c1cccc(Cl)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H15ClN2O2/c22-17-12-7-13-18(14-17)23-24-19(20(25)15-8-3-1-4-9-15)21(26)16-10-5-2-6-11-16/h1-14,19H/b24-23+ |
| InChIKey | XIQRDJHZTGEXOF-WCWDXBQESA-N |
| XLogP | 5.56 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|