C16H13N3O4 — CID 13196027
2-[(3-nitrophenyl)diazenyl]-1-phenylbutane-1,3-dione (PubChem CID 13196027) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)diazenyl]-1-phenylbutane-1,3-dione.
| Compound Name | 2-[(3-nitrophenyl)diazenyl]-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 13196027 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[(3-nitrophenyl)diazenyl]-1-phenylbutane-1,3-dione |
| SMILES | CC(=O)C(/N=N/c1cccc([N+](=O)[O-])c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13N3O4/c1-11(20)15(16(21)12-6-3-2-4-7-12)18-17-13-8-5-9-14(10-13)19(22)23/h2-10,15H,1H3/b18-17+ |
| InChIKey | VBJVKJZEOREPIL-ISLYRVAYSA-N |
| XLogP | 3.52 |
| TPSA | 102.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|