C10H10N3O3- — CID 71664215
2-N-(3-nitrophenyl)-3-N-oxidobutane-2,3-diimine (PubChem CID 71664215) has the molecular formula C10H10N3O3- and a molecular weight of 220.21 g/mol. Its IUPAC name is 2-N-(3-nitrophenyl)-3-N-oxidobutane-2,3-diimine.
| Compound Name | 2-N-(3-nitrophenyl)-3-N-oxidobutane-2,3-diimine |
|---|---|
| PubChem CID | 71664215 |
| Molecular Formula | C10H10N3O3- |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-N-(3-nitrophenyl)-3-N-oxidobutane-2,3-diimine |
| SMILES | CC(=N/[O-])/C(C)=N/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11N3O3/c1-7(8(2)12-14)11-9-4-3-5-10(6-9)13(15)16/h3-6,14H,1-2H3/p-1/b11-7+,12-8- |
| InChIKey | XQLORFLQCIRHRU-RLCSYUECSA-M |
| XLogP | 2.65 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|