About 1-azido-3-nitrobenzene;hydrofluoride
1-azido-3-nitrobenzene;hydrofluoride (PubChem CID 161250805) has the molecular formula C6H5FN4O2
and a molecular weight of 184.13 g/mol. Its IUPAC name is 1-azido-3-nitrobenzene;hydrofluoride.
Molecular Properties
| Compound Name | 1-azido-3-nitrobenzene;hydrofluoride |
| PubChem CID | 161250805 |
| Molecular Formula | C6H5FN4O2 |
| Molecular Weight | 184.13 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 1-azido-3-nitrobenzene;hydrofluoride |
| SMILES | F.[N-]=[N+]=Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N4O2.FH/c7-9-8-5-2-1-3-6(4-5)10(11)12;/h1-4H;1H |
| InChIKey | FKDNGJGOMHPLPB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.13 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-3-nitrobenzene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-3-nitrobenzene;hydrofluoride?
The IUPAC name of 1-azido-3-nitrobenzene;hydrofluoride (CID 161250805) is 1-azido-3-nitrobenzene;hydrofluoride.
What is the SMILES notation for 1-azido-3-nitrobenzene;hydrofluoride?
The canonical SMILES for 1-azido-3-nitrobenzene;hydrofluoride is F.[N-]=[N+]=Nc1cccc([N+](=O)[O-])c1.
What is the InChIKey of 1-azido-3-nitrobenzene;hydrofluoride?
The InChIKey is FKDNGJGOMHPLPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O2.FH/c7-9-8-5-2-1-3-6(4-5)10(11)12;/h1-4H;1H.
What are the key properties of 1-azido-3-nitrobenzene;hydrofluoride?
1-azido-3-nitrobenzene;hydrofluoride has a molecular weight of 184.13 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-3-nitrobenzene;hydrofluoride is sourced from PubChem (CID 161250805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).