C10H10N4O4 — CID 16749260
2-(azidomethyl)-2-(3-nitrophenyl)-1,3-dioxolane (PubChem CID 16749260) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is 2-(azidomethyl)-2-(3-nitrophenyl)-1,3-dioxolane.
| Compound Name | 2-(azidomethyl)-2-(3-nitrophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 16749260 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-(azidomethyl)-2-(3-nitrophenyl)-1,3-dioxolane |
| SMILES | [N-]=[N+]=NCC1(c2cccc([N+](=O)[O-])c2)OCCO1 |
| InChI | InChI=1S/C10H10N4O4/c11-13-12-7-10(17-4-5-18-10)8-2-1-3-9(6-8)14(15)16/h1-3,6H,4-5,7H2 |
| InChIKey | GXDBBYLBFUBMEO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 110.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|