C11H12N4O3 — CID 125455635
(2R,4R)-2-(azidomethyl)-4-(3-nitrophenyl)oxolane (PubChem CID 125455635) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is (2R,4R)-2-(azidomethyl)-4-(3-nitrophenyl)oxolane.
| Compound Name | (2R,4R)-2-(azidomethyl)-4-(3-nitrophenyl)oxolane |
|---|---|
| PubChem CID | 125455635 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (2R,4R)-2-(azidomethyl)-4-(3-nitrophenyl)oxolane |
| SMILES | [N-]=[N+]=NC[C@H]1C[C@H](c2cccc([N+](=O)[O-])c2)CO1 |
| InChI | InChI=1S/C11H12N4O3/c12-14-13-6-11-5-9(7-18-11)8-2-1-3-10(4-8)15(16)17/h1-4,9,11H,5-7H2/t9-,11+/m0/s1 |
| InChIKey | FRBFENZTMHXXPL-GXSJLCMTSA-N |
| XLogP | 2.78 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|