C11H14N2O3 — CID 125455119
[(2R,4R)-4-(3-nitrophenyl)oxolan-2-yl]methanamine (PubChem CID 125455119) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is [(2R,4R)-4-(3-nitrophenyl)oxolan-2-yl]methanamine.
| Compound Name | [(2R,4R)-4-(3-nitrophenyl)oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 125455119 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | [(2R,4R)-4-(3-nitrophenyl)oxolan-2-yl]methanamine |
| SMILES | NC[C@H]1C[C@H](c2cccc([N+](=O)[O-])c2)CO1 |
| InChI | InChI=1S/C11H14N2O3/c12-6-11-5-9(7-16-11)8-2-1-3-10(4-8)13(14)15/h1-4,9,11H,5-7,12H2/t9-,11+/m0/s1 |
| InChIKey | AGVHSJSSGBEGFU-GXSJLCMTSA-N |
| XLogP | 1.43 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|