C10H10BrNO4 — CID 10803249
(4R,5R)-5-bromo-4-(3-nitrophenyl)-1,3-dioxane (PubChem CID 10803249) has the molecular formula C10H10BrNO4 and a molecular weight of 288.10 g/mol. Its IUPAC name is (4R,5R)-5-bromo-4-(3-nitrophenyl)-1,3-dioxane.
| Compound Name | (4R,5R)-5-bromo-4-(3-nitrophenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 10803249 |
| Molecular Formula | C10H10BrNO4 |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | (4R,5R)-5-bromo-4-(3-nitrophenyl)-1,3-dioxane |
| SMILES | O=[N+]([O-])c1cccc([C@H]2OCOC[C@H]2Br)c1 |
| InChI | InChI=1S/C10H10BrNO4/c11-9-5-15-6-16-10(9)7-2-1-3-8(4-7)12(13)14/h1-4,9-10H,5-6H2/t9-,10-/m1/s1 |
| InChIKey | SSNIJAQXADQODQ-NXEZZACHSA-N |
| XLogP | 2.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|