C25H24N2O5 — CID 42604462
(2R,6S)-4-(3,4-dimethylphenyl)-2,6-bis(3-nitrophenyl)oxane (PubChem CID 42604462) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is (2R,6S)-4-(3,4-dimethylphenyl)-2,6-bis(3-nitrophenyl)oxane.
| Compound Name | (2R,6S)-4-(3,4-dimethylphenyl)-2,6-bis(3-nitrophenyl)oxane |
|---|---|
| PubChem CID | 42604462 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (2R,6S)-4-(3,4-dimethylphenyl)-2,6-bis(3-nitrophenyl)oxane |
| SMILES | Cc1ccc(C2C[C@@H](c3cccc([N+](=O)[O-])c3)O[C@@H](c3cccc([N+](=O)[O-])c3)C2)cc1C |
| InChI | InChI=1S/C25H24N2O5/c1-16-9-10-18(11-17(16)2)21-14-24(19-5-3-7-22(12-19)26(28)29)32-25(15-21)20-6-4-8-23(13-20)27(30)31/h3-13,21,24-25H,14-15H2,1-2H3/t21?,24-,25+ |
| InChIKey | XJMMKWNSBQIZKP-UYPFPJBKSA-N |
| XLogP | 6.50 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|