C21H25NO2 — CID 122632001
1,2-dimethyl-4-[4-(3-methyl-4-nitrophenyl)cyclohexyl]benzene (PubChem CID 122632001) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1,2-dimethyl-4-[4-(3-methyl-4-nitrophenyl)cyclohexyl]benzene.
| Compound Name | 1,2-dimethyl-4-[4-(3-methyl-4-nitrophenyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 122632001 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1,2-dimethyl-4-[4-(3-methyl-4-nitrophenyl)cyclohexyl]benzene |
| SMILES | Cc1ccc(C2CCC(c3ccc([N+](=O)[O-])c(C)c3)CC2)cc1C |
| InChI | InChI=1S/C21H25NO2/c1-14-4-5-19(12-15(14)2)17-6-8-18(9-7-17)20-10-11-21(22(23)24)16(3)13-20/h4-5,10-13,17-18H,6-9H2,1-3H3 |
| InChIKey | YOVJPTZDAOLERD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|