C24H28O4 — CID 58348902
[2-acetyloxy-4-[4-(3,4-dimethylphenyl)cyclohexyl]phenyl] acetate (PubChem CID 58348902) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is [2-acetyloxy-4-[4-(3,4-dimethylphenyl)cyclohexyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[4-(3,4-dimethylphenyl)cyclohexyl]phenyl] acetate |
|---|---|
| PubChem CID | 58348902 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [2-acetyloxy-4-[4-(3,4-dimethylphenyl)cyclohexyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2CCC(c3ccc(C)c(C)c3)CC2)cc1OC(C)=O |
| InChI | InChI=1S/C24H28O4/c1-15-5-6-21(13-16(15)2)19-7-9-20(10-8-19)22-11-12-23(27-17(3)25)24(14-22)28-18(4)26/h5-6,11-14,19-20H,7-10H2,1-4H3 |
| InChIKey | RJBSISLYUDBYCI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|