C19H19N5O2 — CID 136668194
(5R,7S)-5-(3,4-dimethylphenyl)-7-(3-nitrophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136668194) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is (5R,7S)-5-(3,4-dimethylphenyl)-7-(3-nitrophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7S)-5-(3,4-dimethylphenyl)-7-(3-nitrophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136668194 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (5R,7S)-5-(3,4-dimethylphenyl)-7-(3-nitrophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccc([C@H]2C[C@@H](c3cccc([N+](=O)[O-])c3)n3ncnc3N2)cc1C |
| InChI | InChI=1S/C19H19N5O2/c1-12-6-7-14(8-13(12)2)17-10-18(23-19(22-17)20-11-21-23)15-4-3-5-16(9-15)24(25)26/h3-9,11,17-18H,10H2,1-2H3,(H,20,21,22)/t17-,18+/m1/s1 |
| InChIKey | UNMIVHZCUNWJSY-MSOLQXFVSA-N |
| XLogP | 3.95 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|