C18H16Cl2N4 — CID 2947052
5-(3,4-dichlorophenyl)-7-(3-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 2947052) has the molecular formula C18H16Cl2N4 and a molecular weight of 359.26 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-7-(3-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-(3,4-dichlorophenyl)-7-(3-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 2947052 |
| Molecular Formula | C18H16Cl2N4 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-7-(3-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cccc(C2CC(c3ccc(Cl)c(Cl)c3)Nc3ncnn32)c1 |
| InChI | InChI=1S/C18H16Cl2N4/c1-11-3-2-4-13(7-11)17-9-16(23-18-21-10-22-24(17)18)12-5-6-14(19)15(20)8-12/h2-8,10,16-17H,9H2,1H3,(H,21,22,23) |
| InChIKey | URVREDSCKFWKNA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |