C19H18ClFN4 — CID 136668187
(5R,7R)-7-(2-chloro-6-fluorophenyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136668187) has the molecular formula C19H18ClFN4 and a molecular weight of 356.83 g/mol. Its IUPAC name is (5R,7R)-7-(2-chloro-6-fluorophenyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7R)-7-(2-chloro-6-fluorophenyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136668187 |
| Molecular Formula | C19H18ClFN4 |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (5R,7R)-7-(2-chloro-6-fluorophenyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccc([C@H]2C[C@H](c3c(F)cccc3Cl)n3ncnc3N2)cc1C |
| InChI | InChI=1S/C19H18ClFN4/c1-11-6-7-13(8-12(11)2)16-9-17(25-19(24-16)22-10-23-25)18-14(20)4-3-5-15(18)21/h3-8,10,16-17H,9H2,1-2H3,(H,22,23,24)/t16-,17-/m1/s1 |
| InChIKey | LZNVQBRDZXFMNM-IAGOWNOFSA-N |
| XLogP | 4.83 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |