C19H20N4 — CID 938557
(5S,7R)-7-(3-methylphenyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 938557) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is (5S,7R)-7-(3-methylphenyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-7-(3-methylphenyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 938557 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (5S,7R)-7-(3-methylphenyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccc([C@@H]2C[C@H](c3cccc(C)c3)n3ncnc3N2)cc1 |
| InChI | InChI=1S/C19H20N4/c1-13-6-8-15(9-7-13)17-11-18(16-5-3-4-14(2)10-16)23-19(22-17)20-12-21-23/h3-10,12,17-18H,11H2,1-2H3,(H,20,21,22)/t17-,18+/m0/s1 |
| InChIKey | QGEWRBICYGEBOT-ZWKOTPCHSA-N |
| XLogP | 4.04 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |