C20H23N5 — CID 137168677
N,N-dimethyl-4-[(5S,7R)-7-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]aniline (PubChem CID 137168677) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[(5S,7R)-7-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]aniline.
| Compound Name | N,N-dimethyl-4-[(5S,7R)-7-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]aniline |
|---|---|
| PubChem CID | 137168677 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | N,N-dimethyl-4-[(5S,7R)-7-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]aniline |
| SMILES | Cc1ccc([C@H]2C[C@@H](c3ccc(N(C)C)cc3)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C20H23N5/c1-14-4-6-16(7-5-14)19-12-18(23-20-21-13-22-25(19)20)15-8-10-17(11-9-15)24(2)3/h4-11,13,18-19H,12H2,1-3H3,(H,21,22,23)/t18-,19+/m0/s1 |
| InChIKey | BFBJXIGZPJPFAT-RBUKOAKNSA-N |
| XLogP | 3.80 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|