C20H21F2N5O — CID 178156441
4-[5-[4-(difluoromethoxy)phenyl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline (PubChem CID 178156441) has the molecular formula C20H21F2N5O and a molecular weight of 385.42 g/mol. Its IUPAC name is 4-[5-[4-(difluoromethoxy)phenyl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-[4-(difluoromethoxy)phenyl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 178156441 |
| Molecular Formula | C20H21F2N5O |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[5-[4-(difluoromethoxy)phenyl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2CC(c3ccc(OC(F)F)cc3)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C20H21F2N5O/c1-26(2)15-7-3-14(4-8-15)18-11-17(25-20-23-12-24-27(18)20)13-5-9-16(10-6-13)28-19(21)22/h3-10,12,17-19H,11H2,1-2H3,(H,23,24,25) |
| InChIKey | DFDWKSUVKVAERN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|