C17H19N5S — CID 3954289
N,N-dimethyl-4-(5-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline (PubChem CID 3954289) has the molecular formula C17H19N5S and a molecular weight of 325.44 g/mol. Its IUPAC name is N,N-dimethyl-4-(5-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline.
| Compound Name | N,N-dimethyl-4-(5-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline |
|---|---|
| PubChem CID | 3954289 |
| Molecular Formula | C17H19N5S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N,N-dimethyl-4-(5-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline |
| SMILES | CN(C)c1ccc(C2CC(c3cccs3)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C17H19N5S/c1-21(2)13-7-5-12(6-8-13)15-10-14(16-4-3-9-23-16)20-17-18-11-19-22(15)17/h3-9,11,14-15H,10H2,1-2H3,(H,18,19,20) |
| InChIKey | OLEVJJXTKBJNDN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|