C12H15N7O2 — CID 135911863
[(5S,7R)-5-methyl-7-(3-nitrophenyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]hydrazine (PubChem CID 135911863) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is [(5S,7R)-5-methyl-7-(3-nitrophenyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]hydrazine.
| Compound Name | [(5S,7R)-5-methyl-7-(3-nitrophenyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]hydrazine |
|---|---|
| PubChem CID | 135911863 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [(5S,7R)-5-methyl-7-(3-nitrophenyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]hydrazine |
| SMILES | C[C@]1(NN)C[C@H](c2cccc([N+](=O)[O-])c2)n2ncnc2N1 |
| InChI | InChI=1S/C12H15N7O2/c1-12(17-13)6-10(18-11(16-12)14-7-15-18)8-3-2-4-9(5-8)19(20)21/h2-5,7,10,17H,6,13H2,1H3,(H,14,15,16)/t10-,12+/m1/s1 |
| InChIKey | DBWHRJNJYISXLF-PWSUYJOCSA-N |
| XLogP | 0.77 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|