C11H9N5O3 — CID 137045183
(7R)-7-(4-nitrophenyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (PubChem CID 137045183) has the molecular formula C11H9N5O3 and a molecular weight of 259.23 g/mol. Its IUPAC name is (7R)-7-(4-nitrophenyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one.
| Compound Name | (7R)-7-(4-nitrophenyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 137045183 |
| Molecular Formula | C11H9N5O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (7R)-7-(4-nitrophenyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| SMILES | O=C1C[C@H](c2ccc([N+](=O)[O-])cc2)n2ncnc2N1 |
| InChI | InChI=1S/C11H9N5O3/c17-10-5-9(15-11(14-10)12-6-13-15)7-1-3-8(4-2-7)16(18)19/h1-4,6,9H,5H2,(H,12,13,14,17)/t9-/m1/s1 |
| InChIKey | JSAPSBSFKXJPNP-SECBINFHSA-N |
| XLogP | 1.12 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|