C18H11N5O3 — CID 135832485
10-(4-nitrophenyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one (PubChem CID 135832485) has the molecular formula C18H11N5O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is 10-(4-nitrophenyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one.
| Compound Name | 10-(4-nitrophenyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one |
|---|---|
| PubChem CID | 135832485 |
| Molecular Formula | C18H11N5O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 10-(4-nitrophenyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one |
| SMILES | O=C1C2=C(Nc3ncnn3C2c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C18H11N5O3/c24-17-13-4-2-1-3-12(13)15-14(17)16(22-18(21-15)19-9-20-22)10-5-7-11(8-6-10)23(25)26/h1-9,16H,(H,19,20,21) |
| InChIKey | SEDXTQRCZIUBFO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|