C25H19N5O3 — CID 136667598
(9S,11S)-11-(4-methylphenyl)-9-(3-nitrophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 136667598) has the molecular formula C25H19N5O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is (9S,11S)-11-(4-methylphenyl)-9-(3-nitrophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9S,11S)-11-(4-methylphenyl)-9-(3-nitrophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 136667598 |
| Molecular Formula | C25H19N5O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (9S,11S)-11-(4-methylphenyl)-9-(3-nitrophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Cc1ccc([C@H]2C3=C(Nc4ncnn42)c2ccccc2O[C@H]3c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H19N5O3/c1-15-9-11-16(12-10-15)23-21-22(28-25-26-14-27-29(23)25)19-7-2-3-8-20(19)33-24(21)17-5-4-6-18(13-17)30(31)32/h2-14,23-24H,1H3,(H,26,27,28)/t23-,24-/m0/s1 |
| InChIKey | YPBBPGWKPLATIX-ZEQRLZLVSA-N |
| XLogP | 5.05 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|