C19H14N4O2 — CID 135577631
(10S)-10-(3-methoxyphenyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one (PubChem CID 135577631) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is (10S)-10-(3-methoxyphenyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one.
| Compound Name | (10S)-10-(3-methoxyphenyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one |
|---|---|
| PubChem CID | 135577631 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (10S)-10-(3-methoxyphenyl)-11,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaen-8-one |
| SMILES | COc1cccc([C@H]2C3=C(Nc4ncnn42)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C19H14N4O2/c1-25-12-6-4-5-11(9-12)17-15-16(22-19-20-10-21-23(17)19)13-7-2-3-8-14(13)18(15)24/h2-10,17H,1H3,(H,20,21,22)/t17-/m0/s1 |
| InChIKey | WGFUNKALDDOXAE-KRWDZBQOSA-N |
| XLogP | 2.91 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |