C19H15ClN4 — CID 800663
(11R)-11-(4-chlorophenyl)-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 800663) has the molecular formula C19H15ClN4 and a molecular weight of 334.81 g/mol. Its IUPAC name is (11R)-11-(4-chlorophenyl)-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (11R)-11-(4-chlorophenyl)-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 800663 |
| Molecular Formula | C19H15ClN4 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (11R)-11-(4-chlorophenyl)-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Clc1ccc([C@@H]2C3=C(Nc4ncnn42)c2ccccc2CC3)cc1 |
| InChI | InChI=1S/C19H15ClN4/c20-14-8-5-13(6-9-14)18-16-10-7-12-3-1-2-4-15(12)17(16)23-19-21-11-22-24(18)19/h1-6,8-9,11,18H,7,10H2,(H,21,22,23)/t18-/m1/s1 |
| InChIKey | GFCLNQMRKBDWHH-GOSISDBHSA-N |
| XLogP | 4.30 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |