C24H15Cl3N4O — CID 4294596
11-(4-chlorophenyl)-9-(2,4-dichlorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 4294596) has the molecular formula C24H15Cl3N4O and a molecular weight of 481.77 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-9-(2,4-dichlorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | 11-(4-chlorophenyl)-9-(2,4-dichlorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 4294596 |
| Molecular Formula | C24H15Cl3N4O |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 11-(4-chlorophenyl)-9-(2,4-dichlorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Clc1ccc(C2C3=C(Nc4ncnn42)c2ccccc2OC3c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C24H15Cl3N4O/c25-14-7-5-13(6-8-14)22-20-21(30-24-28-12-29-31(22)24)17-3-1-2-4-19(17)32-23(20)16-10-9-15(26)11-18(16)27/h1-12,22-23H,(H,28,29,30) |
| InChIKey | NJYCIRZRZFXRHS-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |