C26H20Cl2N4O2 — CID 137077668
(9R,11R)-9-(2,4-dichlorophenyl)-4-methoxy-11-(4-methylphenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 137077668) has the molecular formula C26H20Cl2N4O2 and a molecular weight of 491.38 g/mol. Its IUPAC name is (9R,11R)-9-(2,4-dichlorophenyl)-4-methoxy-11-(4-methylphenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9R,11R)-9-(2,4-dichlorophenyl)-4-methoxy-11-(4-methylphenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 137077668 |
| Molecular Formula | C26H20Cl2N4O2 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | (9R,11R)-9-(2,4-dichlorophenyl)-4-methoxy-11-(4-methylphenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | COc1ccc2c(c1)C1=C([C@H](c3ccc(Cl)cc3Cl)O2)[C@@H](c2ccc(C)cc2)n2ncnc2N1 |
| InChI | InChI=1S/C26H20Cl2N4O2/c1-14-3-5-15(6-4-14)24-22-23(31-26-29-13-30-32(24)26)19-12-17(33-2)8-10-21(19)34-25(22)18-9-7-16(27)11-20(18)28/h3-13,24-25H,1-2H3,(H,29,30,31)/t24-,25+/m1/s1 |
| InChIKey | QXYDSUPPXAUAAY-RPBOFIJWSA-N |
| XLogP | 6.46 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |