C26H20ClFN4O3 — CID 136752562
(9R,11S)-4-chloro-9-(2,5-dimethoxyphenyl)-11-(4-fluorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 136752562) has the molecular formula C26H20ClFN4O3 and a molecular weight of 490.92 g/mol. Its IUPAC name is (9R,11S)-4-chloro-9-(2,5-dimethoxyphenyl)-11-(4-fluorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9R,11S)-4-chloro-9-(2,5-dimethoxyphenyl)-11-(4-fluorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 136752562 |
| Molecular Formula | C26H20ClFN4O3 |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | (9R,11S)-4-chloro-9-(2,5-dimethoxyphenyl)-11-(4-fluorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | COc1ccc(OC)c([C@@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2ccc(F)cc2)n2ncnc2N3)c1 |
| InChI | InChI=1S/C26H20ClFN4O3/c1-33-17-8-10-20(34-2)19(12-17)25-22-23(18-11-15(27)5-9-21(18)35-25)31-26-29-13-30-32(26)24(22)14-3-6-16(28)7-4-14/h3-13,24-25H,1-2H3,(H,29,30,31)/t24-,25-/m0/s1 |
| InChIKey | VEXVRBYXMBSEMZ-DQEYMECFSA-N |
| XLogP | 5.65 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |