C25H18ClFN4O2 — CID 136722997
(9R,11S)-9-(4-chlorophenyl)-11-(4-fluorophenyl)-4-methoxy-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 136722997) has the molecular formula C25H18ClFN4O2 and a molecular weight of 460.90 g/mol. Its IUPAC name is (9R,11S)-9-(4-chlorophenyl)-11-(4-fluorophenyl)-4-methoxy-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9R,11S)-9-(4-chlorophenyl)-11-(4-fluorophenyl)-4-methoxy-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 136722997 |
| Molecular Formula | C25H18ClFN4O2 |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (9R,11S)-9-(4-chlorophenyl)-11-(4-fluorophenyl)-4-methoxy-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | COc1ccc2c(c1)C1=C([C@H](c3ccc(F)cc3)n3ncnc3N1)[C@@H](c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C25H18ClFN4O2/c1-32-18-10-11-20-19(12-18)22-21(24(33-20)15-2-6-16(26)7-3-15)23(14-4-8-17(27)9-5-14)31-25(30-22)28-13-29-31/h2-13,23-24H,1H3,(H,28,29,30)/t23-,24+/m0/s1 |
| InChIKey | NBAYWSXBWUEQIL-BJKOFHAPSA-N |
| XLogP | 5.64 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |