C18H12ClFN4O — CID 5131490
4-chloro-11-(2-fluorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 5131490) has the molecular formula C18H12ClFN4O and a molecular weight of 354.77 g/mol. Its IUPAC name is 4-chloro-11-(2-fluorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | 4-chloro-11-(2-fluorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 5131490 |
| Molecular Formula | C18H12ClFN4O |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 4-chloro-11-(2-fluorophenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Fc1ccccc1C1C2=C(Nc3ncnn31)c1cc(Cl)ccc1OC2 |
| InChI | InChI=1S/C18H12ClFN4O/c19-10-5-6-15-12(7-10)16-13(8-25-15)17(11-3-1-2-4-14(11)20)24-18(23-16)21-9-22-24/h1-7,9,17H,8H2,(H,21,22,23) |
| InChIKey | OFBUFVSZMBDWBU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |