C24H17ClN4O — CID 136742642
(9R,11S)-4-chloro-9,11-diphenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 136742642) has the molecular formula C24H17ClN4O and a molecular weight of 412.88 g/mol. Its IUPAC name is (9R,11S)-4-chloro-9,11-diphenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9R,11S)-4-chloro-9,11-diphenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 136742642 |
| Molecular Formula | C24H17ClN4O |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (9R,11S)-4-chloro-9,11-diphenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Clc1ccc2c(c1)C1=C([C@H](c3ccccc3)n3ncnc3N1)[C@@H](c1ccccc1)O2 |
| InChI | InChI=1S/C24H17ClN4O/c25-17-11-12-19-18(13-17)21-20(23(30-19)16-9-5-2-6-10-16)22(15-7-3-1-4-8-15)29-24(28-21)26-14-27-29/h1-14,22-23H,(H,26,27,28)/t22-,23+/m0/s1 |
| InChIKey | FSAOZVHTZNUKHR-XZOQPEGZSA-N |
| XLogP | 5.49 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |