C25H19ClN4O — CID 136667916
(9R,11S)-9-(4-chlorophenyl)-4-methyl-11-phenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 136667916) has the molecular formula C25H19ClN4O and a molecular weight of 426.91 g/mol. Its IUPAC name is (9R,11S)-9-(4-chlorophenyl)-4-methyl-11-phenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9R,11S)-9-(4-chlorophenyl)-4-methyl-11-phenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 136667916 |
| Molecular Formula | C25H19ClN4O |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (9R,11S)-9-(4-chlorophenyl)-4-methyl-11-phenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Cc1ccc2c(c1)C1=C([C@H](c3ccccc3)n3ncnc3N1)[C@@H](c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C25H19ClN4O/c1-15-7-12-20-19(13-15)22-21(24(31-20)17-8-10-18(26)11-9-17)23(16-5-3-2-4-6-16)30-25(29-22)27-14-28-30/h2-14,23-24H,1H3,(H,27,28,29)/t23-,24+/m0/s1 |
| InChIKey | QYGALYPGJYIWCL-BJKOFHAPSA-N |
| XLogP | 5.80 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |